About 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide
1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide (PubChem CID 141127657) has the molecular formula C17H17N3O5S
and a molecular weight of 375.41 g/mol. Its IUPAC name is 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide |
| PubChem CID | 141127657 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide |
| SMILES | O=C1NC(=O)[C@@H](CS(=O)(=O)NCc2ccc(Oc3ccccc3)cc2)N1 |
| InChI | InChI=1S/C17H17N3O5S/c21-16-15(19-17(22)20-16)11-26(23,24)18-10-12-6-8-14(9-7-12)25-13-4-2-1-3-5-13/h1-9,15,18H,10-11H2,(H2,19,20,21,22)/t15-/m1/s1 |
| InChIKey | WUUNZMSUNQCDNC-OAHLLOKOSA-N |
| XLogP | 1.11 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide?
The IUPAC name of 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide (CID 141127657) is 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide.
What is the SMILES notation for 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide?
The canonical SMILES for 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide is O=C1NC(=O)[C@@H](CS(=O)(=O)NCc2ccc(Oc3ccccc3)cc2)N1.
What is the InChIKey of 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide?
The InChIKey is WUUNZMSUNQCDNC-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H17N3O5S/c21-16-15(19-17(22)20-16)11-26(23,24)18-10-12-6-8-14(9-7-12)25-13-4-2-1-3-5-13/h1-9,15,18H,10-11H2,(H2,19,20,21,22)/t15-/m1/s1.
What are the key properties of 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide?
1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide has a molecular weight of 375.41 g/mol, XLogP of 1.11, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-[(4-phenoxyphenyl)methyl]methanesulfonamide is sourced from PubChem (CID 141127657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).