C11H12ClN3O4S — CID 110722375
1-(4-chlorophenyl)-N-[(2,5-dioxoimidazolidin-4-yl)methyl]methanesulfonamide (PubChem CID 110722375) has the molecular formula C11H12ClN3O4S and a molecular weight of 317.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2,5-dioxoimidazolidin-4-yl)methyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2,5-dioxoimidazolidin-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 110722375 |
| Molecular Formula | C11H12ClN3O4S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2,5-dioxoimidazolidin-4-yl)methyl]methanesulfonamide |
| SMILES | O=C1NC(=O)C(CNS(=O)(=O)Cc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C11H12ClN3O4S/c12-8-3-1-7(2-4-8)6-20(18,19)13-5-9-10(16)15-11(17)14-9/h1-4,9,13H,5-6H2,(H2,14,15,16,17) |
| InChIKey | QAYGLEZTGAJEIS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|