C18H20ClFN2O2S — CID 110640715
1-(4-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]methanesulfonamide (PubChem CID 110640715) has the molecular formula C18H20ClFN2O2S and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 110640715 |
| Molecular Formula | C18H20ClFN2O2S |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)NCC1CCN(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H20ClFN2O2S/c19-16-3-1-14(2-4-16)13-25(23,24)21-11-15-9-10-22(12-15)18-7-5-17(20)6-8-18/h1-8,15,21H,9-13H2 |
| InChIKey | BYVBDOQUGCBGEX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |