C18H15ClN2OS — CID 121165718
2-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]acetamide (PubChem CID 121165718) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 121165718 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCc1ccnc(-c2ccsc2)c1 |
| InChI | InChI=1S/C18H15ClN2OS/c19-16-3-1-13(2-4-16)10-18(22)21-11-14-5-7-20-17(9-14)15-6-8-23-12-15/h1-9,12H,10-11H2,(H,21,22) |
| InChIKey | OFEOJQRREDNGSZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |