C22H21ClN2OS — CID 121165751
1-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]cyclopentane-1-carboxamide (PubChem CID 121165751) has the molecular formula C22H21ClN2OS and a molecular weight of 396.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121165751 |
| Molecular Formula | C22H21ClN2OS |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCc1ccnc(-c2ccsc2)c1)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C22H21ClN2OS/c23-19-5-3-18(4-6-19)22(9-1-2-10-22)21(26)25-14-16-7-11-24-20(13-16)17-8-12-27-15-17/h3-8,11-13,15H,1-2,9-10,14H2,(H,25,26) |
| InChIKey | FTXBXCPWRXHHOX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |