C25H30N2OS — CID 121165766
3,5-ditert-butyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide (PubChem CID 121165766) has the molecular formula C25H30N2OS and a molecular weight of 406.60 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide.
| Compound Name | 3,5-ditert-butyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 121165766 |
| Molecular Formula | C25H30N2OS |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3,5-ditert-butyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)NCc2ccnc(-c3ccsc3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H30N2OS/c1-24(2,3)20-12-19(13-21(14-20)25(4,5)6)23(28)27-15-17-7-9-26-22(11-17)18-8-10-29-16-18/h7-14,16H,15H2,1-6H3,(H,27,28) |
| InChIKey | HZMUAZIPYVTUIV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |