C15H11ClN2OS2 — CID 91625615
5-chloro-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]thiophene-2-carboxamide (PubChem CID 91625615) has the molecular formula C15H11ClN2OS2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 5-chloro-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91625615 |
| Molecular Formula | C15H11ClN2OS2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 5-chloro-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccnc(-c2ccsc2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H11ClN2OS2/c16-14-2-1-13(21-14)15(19)18-8-10-3-5-17-12(7-10)11-4-6-20-9-11/h1-7,9H,8H2,(H,18,19) |
| InChIKey | TWIKZJOSENWUEU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |