C18H16N2OS2 — CID 91625621
2-methylsulfanyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide (PubChem CID 91625621) has the molecular formula C18H16N2OS2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide.
| Compound Name | 2-methylsulfanyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 91625621 |
| Molecular Formula | C18H16N2OS2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-methylsulfanyl-N-[(2-thiophen-3-yl-4-pyridinyl)methyl]benzamide |
| SMILES | CSc1ccccc1C(=O)NCc1ccnc(-c2ccsc2)c1 |
| InChI | InChI=1S/C18H16N2OS2/c1-22-17-5-3-2-4-15(17)18(21)20-11-13-6-8-19-16(10-13)14-7-9-23-12-14/h2-10,12H,11H2,1H3,(H,20,21) |
| InChIKey | RTVFLOBNCGNLPR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |