C26H31NO — CID 87493735
2,4,6-trimethyl-N-[[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)phenyl]methyl]benzamide (PubChem CID 87493735) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)phenyl]methyl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87493735 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2,4,6-trimethyl-N-[[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)phenyl]methyl]benzamide |
| SMILES | CC1=C(C)C(C)C(c2ccccc2CNC(=O)c2c(C)cc(C)cc2C)=C1C |
| InChI | InChI=1S/C26H31NO/c1-15-12-16(2)24(17(3)13-15)26(28)27-14-22-10-8-9-11-23(22)25-20(6)18(4)19(5)21(25)7/h8-13,20H,14H2,1-7H3,(H,27,28) |
| InChIKey | PQIXNWGLOCZLCA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |