C11H15BrO4 — CID 175796351
1-bromo-1-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 175796351) has the molecular formula C11H15BrO4 and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-bromo-1-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 1-bromo-1-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 175796351 |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1-bromo-1-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(C(C)(O)Br)cc(OC)c1OC |
| InChI | InChI=1S/C11H15BrO4/c1-11(12,13)7-5-8(14-2)10(16-4)9(6-7)15-3/h5-6,13H,1-4H3 |
| InChIKey | FCJPWUXKTMNAIN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|