C11H14BrFO2 — CID 84714628
1-bromo-5-(2-fluoropropan-2-yl)-2,3-dimethoxybenzene (PubChem CID 84714628) has the molecular formula C11H14BrFO2 and a molecular weight of 277.13 g/mol. Its IUPAC name is 1-bromo-5-(2-fluoropropan-2-yl)-2,3-dimethoxybenzene.
| Compound Name | 1-bromo-5-(2-fluoropropan-2-yl)-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 84714628 |
| Molecular Formula | C11H14BrFO2 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-bromo-5-(2-fluoropropan-2-yl)-2,3-dimethoxybenzene |
| SMILES | COc1cc(C(C)(C)F)cc(Br)c1OC |
| InChI | InChI=1S/C11H14BrFO2/c1-11(2,13)7-5-8(12)10(15-4)9(6-7)14-3/h5-6H,1-4H3 |
| InChIKey | KCXZLVPURWYFCK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |