C10H15BO4 — CID 142167144
methyl-(3,4,5-trimethoxyphenyl)borinic acid (PubChem CID 142167144) has the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. Its IUPAC name is methyl-(3,4,5-trimethoxyphenyl)borinic acid.
| Compound Name | methyl-(3,4,5-trimethoxyphenyl)borinic acid |
|---|---|
| PubChem CID | 142167144 |
| Molecular Formula | C10H15BO4 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl-(3,4,5-trimethoxyphenyl)borinic acid |
| SMILES | COc1cc(B(C)O)cc(OC)c1OC |
| InChI | InChI=1S/C10H15BO4/c1-11(12)7-5-8(13-2)10(15-4)9(6-7)14-3/h5-6,12H,1-4H3 |
| InChIKey | GWQBRZYKKDRUQZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|