C15H24O3 — CID 117384454
2-(5-tert-butyl-2,3-dimethoxyphenyl)propan-1-ol (PubChem CID 117384454) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(5-tert-butyl-2,3-dimethoxyphenyl)propan-1-ol.
| Compound Name | 2-(5-tert-butyl-2,3-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117384454 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-(5-tert-butyl-2,3-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(C(C)(C)C)cc(C(C)CO)c1OC |
| InChI | InChI=1S/C15H24O3/c1-10(9-16)12-7-11(15(2,3)4)8-13(17-5)14(12)18-6/h7-8,10,16H,9H2,1-6H3 |
| InChIKey | JRZSNVFALNVOJZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |