C12H17F2NO3 — CID 117406771
2-amino-1-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]ethanol (PubChem CID 117406771) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-amino-1-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]ethanol.
| Compound Name | 2-amino-1-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]ethanol |
|---|---|
| PubChem CID | 117406771 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-amino-1-[5-(1,1-difluoroethyl)-2,3-dimethoxyphenyl]ethanol |
| SMILES | COc1cc(C(C)(F)F)cc(C(O)CN)c1OC |
| InChI | InChI=1S/C12H17F2NO3/c1-12(13,14)7-4-8(9(16)6-15)11(18-3)10(5-7)17-2/h4-5,9,16H,6,15H2,1-3H3 |
| InChIKey | XJZUNLZFJPHROK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |