C12H15NO3 — CID 117315562
3-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzonitrile (PubChem CID 117315562) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzonitrile.
| Compound Name | 3-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117315562 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(C(C)CO)c1OC |
| InChI | InChI=1S/C12H15NO3/c1-8(7-14)10-4-9(6-13)5-11(15-2)12(10)16-3/h4-5,8,14H,7H2,1-3H3 |
| InChIKey | AYUJSJYJENQBQK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |