C10H18NO2PS — CID 145462557
3,4-dimethoxy-N-methyl-5-phosphanylaniline;methanethiol (PubChem CID 145462557) has the molecular formula C10H18NO2PS and a molecular weight of 247.30 g/mol. Its IUPAC name is 3,4-dimethoxy-N-methyl-5-phosphanylaniline;methanethiol.
| Compound Name | 3,4-dimethoxy-N-methyl-5-phosphanylaniline;methanethiol |
|---|---|
| PubChem CID | 145462557 |
| Molecular Formula | C10H18NO2PS |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3,4-dimethoxy-N-methyl-5-phosphanylaniline;methanethiol |
| SMILES | CNc1cc(P)c(OC)c(OC)c1.CS |
| InChI | InChI=1S/C9H14NO2P.CH4S/c1-10-6-4-7(11-2)9(12-3)8(13)5-6;1-2/h4-5,10H,13H2,1-3H3;2H,1H3 |
| InChIKey | AHYGHWBPOBJJGJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|