C9H14N2O2 — CID 163969412
4,5-dimethoxy-3-N-methylbenzene-1,3-diamine (PubChem CID 163969412) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4,5-dimethoxy-3-N-methylbenzene-1,3-diamine.
| Compound Name | 4,5-dimethoxy-3-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 163969412 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4,5-dimethoxy-3-N-methylbenzene-1,3-diamine |
| SMILES | CNc1cc(N)cc(OC)c1OC |
| InChI | InChI=1S/C9H14N2O2/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5,11H,10H2,1-3H3 |
| InChIKey | SORAVHOODHGIOX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|