C15H18N2O4 — CID 104537032
N-methyl-5-(3,4,5-trimethoxyphenoxy)pyridin-3-amine (PubChem CID 104537032) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-methyl-5-(3,4,5-trimethoxyphenoxy)pyridin-3-amine.
| Compound Name | N-methyl-5-(3,4,5-trimethoxyphenoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 104537032 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-methyl-5-(3,4,5-trimethoxyphenoxy)pyridin-3-amine |
| SMILES | CNc1cncc(Oc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-16-10-5-12(9-17-8-10)21-11-6-13(18-2)15(20-4)14(7-11)19-3/h5-9,16H,1-4H3 |
| InChIKey | ADSJHLQYFPUSFY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |