C36H44O12P2 — CID 59787533
(3,4,5-trimethoxyphenyl)-[3,4,5-trimethoxy-2-[2,3,4-trimethoxy-6-(3,4,5-trimethoxyphenyl)phosphanylphenyl]phenyl]phosphane (PubChem CID 59787533) has the molecular formula C36H44O12P2 and a molecular weight of 730.68 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)-[3,4,5-trimethoxy-2-[2,3,4-trimethoxy-6-(3,4,5-trimethoxyphenyl)phosphanylphenyl]phenyl]phosphane.
| Compound Name | (3,4,5-trimethoxyphenyl)-[3,4,5-trimethoxy-2-[2,3,4-trimethoxy-6-(3,4,5-trimethoxyphenyl)phosphanylphenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 59787533 |
| Molecular Formula | C36H44O12P2 |
| Molecular Weight | 730.68 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)-[3,4,5-trimethoxy-2-[2,3,4-trimethoxy-6-(3,4,5-trimethoxyphenyl)phosphanylphenyl]phenyl]phosphane |
| SMILES | COc1cc(Pc2cc(OC)c(OC)c(OC)c2-c2c(Pc3cc(OC)c(OC)c(OC)c3)cc(OC)c(OC)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C36H44O12P2/c1-37-21-13-19(14-22(38-2)31(21)43-7)49-27-17-25(41-5)33(45-9)35(47-11)29(27)30-28(18-26(42-6)34(46-10)36(30)48-12)50-20-15-23(39-3)32(44-8)24(16-20)40-4/h13-18,49-50H,1-12H3 |
| InChIKey | SPIPSCNYDITRBE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|