C19H26INO2 — CID 44727251
2,3-dimethoxy-7-methyl-5,6,8,8a,9,12,12a,12b-octahydroisoindolo[1,2-a]isoquinolin-7-ium iodide (PubChem CID 44727251) has the molecular formula C19H26INO2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2,3-dimethoxy-7-methyl-5,6,8,8a,9,12,12a,12b-octahydroisoindolo[1,2-a]isoquinolin-7-ium iodide.
| Compound Name | 2,3-dimethoxy-7-methyl-5,6,8,8a,9,12,12a,12b-octahydroisoindolo[1,2-a]isoquinolin-7-ium iodide |
|---|---|
| PubChem CID | 44727251 |
| Molecular Formula | C19H26INO2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2,3-dimethoxy-7-methyl-5,6,8,8a,9,12,12a,12b-octahydroisoindolo[1,2-a]isoquinolin-7-ium iodide |
| SMILES | COc1cc2c(cc1OC)C1C3CC=CCC3C[N+]1(C)CC2.[I-] |
| InChI | InChI=1S/C19H26NO2.HI/c1-20-9-8-13-10-17(21-2)18(22-3)11-16(13)19(20)15-7-5-4-6-14(15)12-20;/h4-5,10-11,14-15,19H,6-9,12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CDJPXSLQCWJCRI-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|