C16H26INO3 — CID 44656405
1-[(1S)-6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-2-ol iodide (PubChem CID 44656405) has the molecular formula C16H26INO3 and a molecular weight of 407.29 g/mol. Its IUPAC name is 1-[(1S)-6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-2-ol iodide.
| Compound Name | 1-[(1S)-6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-2-ol iodide |
|---|---|
| PubChem CID | 44656405 |
| Molecular Formula | C16H26INO3 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-[(1S)-6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propan-2-ol iodide |
| SMILES | COc1cc2c(cc1OC)[C@H](C)[N+](C)(CC(C)O)CC2.[I-] |
| InChI | InChI=1S/C16H26NO3.HI/c1-11(18)10-17(3)7-6-13-8-15(19-4)16(20-5)9-14(13)12(17)2;/h8-9,11-12,18H,6-7,10H2,1-5H3;1H/q+1;/p-1/t11?,12-,17?;/m0./s1 |
| InChIKey | BBAAQDMNYAMCBI-KJXNBJCMSA-M |
| XLogP | -0.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|