C15H21ClNO2+ — CID 14867721
(1S,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-methyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium (PubChem CID 14867721) has the molecular formula C15H21ClNO2+ and a molecular weight of 282.79 g/mol. Its IUPAC name is (1S,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-methyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium.
| Compound Name | (1S,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-methyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium |
|---|---|
| PubChem CID | 14867721 |
| Molecular Formula | C15H21ClNO2+ |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1S,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-methyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](CCl)C[N+]1(C)CC2 |
| InChI | InChI=1S/C15H21ClNO2/c1-17-5-4-10-6-13(18-2)14(19-3)7-12(10)15(17)11(8-16)9-17/h6-7,11,15H,4-5,8-9H2,1-3H3/q+1/t11-,15+,17?/m0/s1 |
| InChIKey | YYCWFMVMJHXYRM-HAHZRWCASA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|