C17H23ClNO2+ — CID 14867731
(1R,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-prop-2-enyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium (PubChem CID 14867731) has the molecular formula C17H23ClNO2+ and a molecular weight of 308.83 g/mol. Its IUPAC name is (1R,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-prop-2-enyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium.
| Compound Name | (1R,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-prop-2-enyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium |
|---|---|
| PubChem CID | 14867731 |
| Molecular Formula | C17H23ClNO2+ |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1R,9bR)-1-(chloromethyl)-7,8-dimethoxy-3-prop-2-enyl-2,4,5,9b-tetrahydro-1H-azeto[2,1-a]isoquinolin-3-ium |
| SMILES | C=CC[N+]12CCc3cc(OC)c(OC)cc3[C@H]1[C@H](CCl)C2 |
| InChI | InChI=1S/C17H23ClNO2/c1-4-6-19-7-5-12-8-15(20-2)16(21-3)9-14(12)17(19)13(10-18)11-19/h4,8-9,13,17H,1,5-7,10-11H2,2-3H3/q+1/t13-,17-,19?/m1/s1 |
| InChIKey | PPRBSFQOUWRHNB-BZSPAODLSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|