C21H24O8S — CID 166921870
[3-[5-(hydroxymethyl)-2-(oxiran-2-ylmethoxy)-3-sulfanyloxyphenyl]-5-methoxy-4-(oxiran-2-ylmethoxy)phenyl]methanol (PubChem CID 166921870) has the molecular formula C21H24O8S and a molecular weight of 436.48 g/mol. Its IUPAC name is [3-[5-(hydroxymethyl)-2-(oxiran-2-ylmethoxy)-3-sulfanyloxyphenyl]-5-methoxy-4-(oxiran-2-ylmethoxy)phenyl]methanol.
| Compound Name | [3-[5-(hydroxymethyl)-2-(oxiran-2-ylmethoxy)-3-sulfanyloxyphenyl]-5-methoxy-4-(oxiran-2-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 166921870 |
| Molecular Formula | C21H24O8S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [3-[5-(hydroxymethyl)-2-(oxiran-2-ylmethoxy)-3-sulfanyloxyphenyl]-5-methoxy-4-(oxiran-2-ylmethoxy)phenyl]methanol |
| SMILES | COc1cc(CO)cc(-c2cc(CO)cc(OS)c2OCC2CO2)c1OCC1CO1 |
| InChI | InChI=1S/C21H24O8S/c1-24-18-4-12(6-22)2-16(20(18)27-10-14-8-25-14)17-3-13(7-23)5-19(29-30)21(17)28-11-15-9-26-15/h2-5,14-15,22-23,30H,6-11H2,1H3 |
| InChIKey | ALMAGROTLBGOQH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|