About 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate
3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate (PubChem CID 170181346) has the molecular formula C19H28O6
and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate |
| PubChem CID | 170181346 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate |
| SMILES | COc1cc(CCCOC(=O)C(C)(C)C)cc(OC)c1OCC1CO1 |
| InChI | InChI=1S/C19H28O6/c1-19(2,3)18(20)23-8-6-7-13-9-15(21-4)17(16(10-13)22-5)25-12-14-11-24-14/h9-10,14H,6-8,11-12H2,1-5H3 |
| InChIKey | PPIBXIJNOICEFI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate?
The IUPAC name of 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate (CID 170181346) is 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate.
What is the SMILES notation for 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate?
The canonical SMILES for 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate is COc1cc(CCCOC(=O)C(C)(C)C)cc(OC)c1OCC1CO1.
What is the InChIKey of 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate?
The InChIKey is PPIBXIJNOICEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O6/c1-19(2,3)18(20)23-8-6-7-13-9-15(21-4)17(16(10-13)22-5)25-12-14-11-24-14/h9-10,14H,6-8,11-12H2,1-5H3.
What are the key properties of 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate?
3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate has a molecular weight of 352.43 g/mol, XLogP of 3.00, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]propyl 2,2-dimethylpropanoate is sourced from PubChem (CID 170181346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).