C23H26O7 — CID 90147696
[4-(hydroxymethyl)-6-methoxy-9,10-bis(oxiran-2-ylmethoxy)-5,8-dihydroanthracen-2-yl]methanol (PubChem CID 90147696) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [4-(hydroxymethyl)-6-methoxy-9,10-bis(oxiran-2-ylmethoxy)-5,8-dihydroanthracen-2-yl]methanol.
| Compound Name | [4-(hydroxymethyl)-6-methoxy-9,10-bis(oxiran-2-ylmethoxy)-5,8-dihydroanthracen-2-yl]methanol |
|---|---|
| PubChem CID | 90147696 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [4-(hydroxymethyl)-6-methoxy-9,10-bis(oxiran-2-ylmethoxy)-5,8-dihydroanthracen-2-yl]methanol |
| SMILES | COC1=CCc2c(c(OCC3CO3)c3c(CO)cc(CO)cc3c2OCC2CO2)C1 |
| InChI | InChI=1S/C23H26O7/c1-26-15-2-3-18-19(6-15)23(30-12-17-10-28-17)21-14(8-25)4-13(7-24)5-20(21)22(18)29-11-16-9-27-16/h2,4-5,16-17,24-25H,3,6-12H2,1H3 |
| InChIKey | ZADDRVVANULHAQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|