C11H11NO2S — CID 102062207
3-methoxy-6-(oxiran-2-ylmethyl)-1,2-benzothiazole (PubChem CID 102062207) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-methoxy-6-(oxiran-2-ylmethyl)-1,2-benzothiazole.
| Compound Name | 3-methoxy-6-(oxiran-2-ylmethyl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 102062207 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-methoxy-6-(oxiran-2-ylmethyl)-1,2-benzothiazole |
| SMILES | COc1nsc2cc(CC3CO3)ccc12 |
| InChI | InChI=1S/C11H11NO2S/c1-13-11-9-3-2-7(4-8-6-14-8)5-10(9)15-12-11/h2-3,5,8H,4,6H2,1H3 |
| InChIKey | TWBQADJNPZWBCH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|