C12H13BrO2 — CID 177437623
2-[(5-bromo-2-prop-2-enoxyphenyl)methyl]oxirane (PubChem CID 177437623) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-[(5-bromo-2-prop-2-enoxyphenyl)methyl]oxirane.
| Compound Name | 2-[(5-bromo-2-prop-2-enoxyphenyl)methyl]oxirane |
|---|---|
| PubChem CID | 177437623 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-[(5-bromo-2-prop-2-enoxyphenyl)methyl]oxirane |
| SMILES | C=CCOc1ccc(Br)cc1CC1CO1 |
| InChI | InChI=1S/C12H13BrO2/c1-2-5-14-12-4-3-10(13)6-9(12)7-11-8-15-11/h2-4,6,11H,1,5,7-8H2 |
| InChIKey | JYNNXHPYYUENQT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|