C14H12N2O2 — CID 68591592
5,6-bis(prop-2-enyl)quinoxaline-2,3-dione (PubChem CID 68591592) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5,6-bis(prop-2-enyl)quinoxaline-2,3-dione.
| Compound Name | 5,6-bis(prop-2-enyl)quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 68591592 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5,6-bis(prop-2-enyl)quinoxaline-2,3-dione |
| SMILES | C=CCc1ccc2c(c1CC=C)=NC(=O)C(=O)N=2 |
| InChI | InChI=1S/C14H12N2O2/c1-3-5-9-7-8-11-12(10(9)6-4-2)16-14(18)13(17)15-11/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | XCLKSROBTRQMIU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|