About formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene
formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene (PubChem CID 174896906) has the molecular formula C20H20O4S
and a molecular weight of 356.44 g/mol. Its IUPAC name is formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene.
Molecular Properties
| Compound Name | formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene |
| PubChem CID | 174896906 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.C=O.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S.C9H10.CH2O/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-2-6-9-7-4-3-5-8-9;1-2/h1-7H,(H,11,12,13);2-5,7-8H,1,6H2;1H2 |
| InChIKey | JXVUIAXPYJJRHO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene?
The IUPAC name of formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene (CID 174896906) is formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene.
What is the SMILES notation for formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene?
The canonical SMILES for formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene is C=CCc1ccccc1.C=O.O=S(=O)(O)c1cccc2ccccc12.
What is the InChIKey of formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene?
The InChIKey is JXVUIAXPYJJRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.C9H10.CH2O/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-2-6-9-7-4-3-5-8-9;1-2/h1-7H,(H,11,12,13);2-5,7-8H,1,6H2;1H2.
What are the key properties of formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene?
formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene has a molecular weight of 356.44 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;naphthalene-1-sulfonic acid;prop-2-enylbenzene is sourced from PubChem (CID 174896906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).