C13H16Cl2N2 — CID 174668389
4-(2,3-dichlorophenyl)cyclohexa-2,4-diene-1,1-diamine;methane (PubChem CID 174668389) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)cyclohexa-2,4-diene-1,1-diamine;methane.
| Compound Name | 4-(2,3-dichlorophenyl)cyclohexa-2,4-diene-1,1-diamine;methane |
|---|---|
| PubChem CID | 174668389 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(2,3-dichlorophenyl)cyclohexa-2,4-diene-1,1-diamine;methane |
| SMILES | C.NC1(N)C=CC(c2cccc(Cl)c2Cl)=CC1 |
| InChI | InChI=1S/C12H12Cl2N2.CH4/c13-10-3-1-2-9(11(10)14)8-4-6-12(15,16)7-5-8;/h1-6H,7,15-16H2;1H4 |
| InChIKey | YKAYSGLOOCJBEW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|