C14H14N2O4 — CID 70193751
6,6-diamino-3-(3-carboxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 70193751) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6,6-diamino-3-(3-carboxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6,6-diamino-3-(3-carboxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70193751 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6,6-diamino-3-(3-carboxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1(N)C=CC(c2cccc(C(=O)O)c2)=CC1C(=O)O |
| InChI | InChI=1S/C14H14N2O4/c15-14(16)5-4-9(7-11(14)13(19)20)8-2-1-3-10(6-8)12(17)18/h1-7,11H,15-16H2,(H,17,18)(H,19,20) |
| InChIKey | UCIRXKCHJRUVJC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|