C30H34N2O2 — CID 175092340
2-N,2-N-dicyclohexyl-4-phenylnaphthalene-2,6-dicarboxamide (PubChem CID 175092340) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is 2-N,2-N-dicyclohexyl-4-phenylnaphthalene-2,6-dicarboxamide.
| Compound Name | 2-N,2-N-dicyclohexyl-4-phenylnaphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 175092340 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2-N,2-N-dicyclohexyl-4-phenylnaphthalene-2,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2cc(C(=O)N(C3CCCCC3)C3CCCCC3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C30H34N2O2/c31-29(33)23-17-16-22-18-24(20-27(28(22)19-23)21-10-4-1-5-11-21)30(34)32(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1,4-5,10-11,16-20,25-26H,2-3,6-9,12-15H2,(H2,31,33) |
| InChIKey | ZAMVBSLFPACQCH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |