C20H24N2O4 — CID 18691056
benzamide;3-cyclopentyloxy-4-methoxybenzamide (PubChem CID 18691056) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzamide;3-cyclopentyloxy-4-methoxybenzamide.
| Compound Name | benzamide;3-cyclopentyloxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 18691056 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzamide;3-cyclopentyloxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1OC1CCCC1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3.C7H7NO/c1-16-11-7-6-9(13(14)15)8-12(11)17-10-4-2-3-5-10;8-7(9)6-4-2-1-3-5-6/h6-8,10H,2-5H2,1H3,(H2,14,15);1-5H,(H2,8,9) |
| InChIKey | KRGBEUJEFOIMAY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |