C20H23NO3 — CID 57432829
(NZ)-N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethylidene]hydroxylamine (PubChem CID 57432829) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (NZ)-N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 57432829 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (NZ)-N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-phenylethylidene]hydroxylamine |
| SMILES | COc1ccc(/C(Cc2ccccc2)=N\O)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H23NO3/c1-23-19-12-11-16(14-20(19)24-17-9-5-6-10-17)18(21-22)13-15-7-3-2-4-8-15/h2-4,7-8,11-12,14,17,22H,5-6,9-10,13H2,1H3/b21-18- |
| InChIKey | JJJGROIGPJBFRR-UZYVYHOESA-N |
| XLogP | 4.44 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|