C20H21Cl2N3O4 — CID 173256484
[[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]amino] carbamate (PubChem CID 173256484) has the molecular formula C20H21Cl2N3O4 and a molecular weight of 438.31 g/mol. Its IUPAC name is [[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]amino] carbamate.
| Compound Name | [[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]amino] carbamate |
|---|---|
| PubChem CID | 173256484 |
| Molecular Formula | C20H21Cl2N3O4 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]amino] carbamate |
| SMILES | COc1ccc(C(Cc2cc(Cl)nc(Cl)c2)=NOC(N)=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H21Cl2N3O4/c1-27-16-7-6-13(11-17(16)28-14-4-2-3-5-14)15(25-29-20(23)26)8-12-9-18(21)24-19(22)10-12/h6-7,9-11,14H,2-5,8H2,1H3,(H2,23,26) |
| InChIKey | PRUIMGDKRDVROK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|