C35H31Cl4N5O5 — CID 87629927
N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]hydroxylamine;N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide (PubChem CID 87629927) has the molecular formula C35H31Cl4N5O5 and a molecular weight of 743.48 g/mol. Its IUPAC name is N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]hydroxylamine;N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide.
| Compound Name | N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]hydroxylamine;N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide |
|---|---|
| PubChem CID | 87629927 |
| Molecular Formula | C35H31Cl4N5O5 |
| Molecular Weight | 743.48 g/mol |
| Exact Mass | 741.11 |
| IUPAC Name | N-[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(2,6-dichloro-4-pyridinyl)ethylidene]hydroxylamine;N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(Cl)cnc2Cl)c2cccnc12.COc1ccc(C(Cc2cc(Cl)nc(Cl)c2)=NO)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H20Cl2N2O3.C16H11Cl2N3O2/c1-25-16-7-6-13(11-17(16)26-14-4-2-3-5-14)15(23-24)8-12-9-18(20)22-19(21)10-12;1-23-13-5-4-11(10-3-2-6-19-14(10)13)16(22)21-12-7-9(17)8-20-15(12)18/h6-7,9-11,14,24H,2-5,8H2,1H3;2-8H,1H3,(H,21,22) |
| InChIKey | TXWOTQIBMFXTSH-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.48 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|