C16H12Cl2N3O2+ — CID 142801468
N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinolin-1-ium-5-carboxamide (PubChem CID 142801468) has the molecular formula C16H12Cl2N3O2+ and a molecular weight of 349.20 g/mol. Its IUPAC name is N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinolin-1-ium-5-carboxamide.
| Compound Name | N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinolin-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 142801468 |
| Molecular Formula | C16H12Cl2N3O2+ |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinolin-1-ium-5-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(Cl)cnc2Cl)c2ccc[nH+]c12 |
| InChI | InChI=1S/C16H11Cl2N3O2/c1-23-13-5-4-11(10-3-2-6-19-14(10)13)16(22)21-12-7-9(17)8-20-15(12)18/h2-8H,1H3,(H,21,22)/p+1 |
| InChIKey | FSDOTMQXIKBFKJ-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|