C15H9Cl2N3O2 — CID 87101826
N-(2,5-dichloro-3-pyridinyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 87101826) has the molecular formula C15H9Cl2N3O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is N-(2,5-dichloro-3-pyridinyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(2,5-dichloro-3-pyridinyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87101826 |
| Molecular Formula | C15H9Cl2N3O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | N-(2,5-dichloro-3-pyridinyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cnc1Cl)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C15H9Cl2N3O2/c16-8-5-12(14(17)19-6-8)20-15(22)10-7-18-11-4-2-1-3-9(11)13(10)21/h1-7H,(H,18,21)(H,20,22) |
| InChIKey | SULWDSBQPIPYAP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|