C24H23Cl3N2O2 — CID 22747685
N-(2-chlorophenyl)-3-cyclopentyloxy-N-[(2,6-dichloro-4-pyridinyl)methyl]-4-methoxyaniline (PubChem CID 22747685) has the molecular formula C24H23Cl3N2O2 and a molecular weight of 477.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-cyclopentyloxy-N-[(2,6-dichloro-4-pyridinyl)methyl]-4-methoxyaniline.
| Compound Name | N-(2-chlorophenyl)-3-cyclopentyloxy-N-[(2,6-dichloro-4-pyridinyl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 22747685 |
| Molecular Formula | C24H23Cl3N2O2 |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-(2-chlorophenyl)-3-cyclopentyloxy-N-[(2,6-dichloro-4-pyridinyl)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(N(Cc2cc(Cl)nc(Cl)c2)c2ccccc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H23Cl3N2O2/c1-30-21-11-10-17(14-22(21)31-18-6-2-3-7-18)29(20-9-5-4-8-19(20)25)15-16-12-23(26)28-24(27)13-16/h4-5,8-14,18H,2-3,6-7,15H2,1H3 |
| InChIKey | PRQVUCJEVUNKDV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|