C23H21NO3 — CID 10594629
4-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]benzamide (PubChem CID 10594629) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]benzamide.
| Compound Name | 4-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 10594629 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[3-(2,3-dihydro-1H-inden-2-yloxy)-4-methoxyphenyl]benzamide |
| SMILES | COc1ccc(-c2ccc(C(N)=O)cc2)cc1OC1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H21NO3/c1-26-21-11-10-19(15-6-8-16(9-7-15)23(24)25)14-22(21)27-20-12-17-4-2-3-5-18(17)13-20/h2-11,14,20H,12-13H2,1H3,(H2,24,25) |
| InChIKey | NCSNXSRDMMPNSI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |