C31H45NO — CID 70433032
1-butyl-4-[(1R)-1-octoxy-4-phenylcyclohexa-2,4-dien-1-yl]cyclohexane-1-carbonitrile (PubChem CID 70433032) has the molecular formula C31H45NO and a molecular weight of 447.71 g/mol. Its IUPAC name is 1-butyl-4-[(1R)-1-octoxy-4-phenylcyclohexa-2,4-dien-1-yl]cyclohexane-1-carbonitrile.
| Compound Name | 1-butyl-4-[(1R)-1-octoxy-4-phenylcyclohexa-2,4-dien-1-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 70433032 |
| Molecular Formula | C31H45NO |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | 1-butyl-4-[(1R)-1-octoxy-4-phenylcyclohexa-2,4-dien-1-yl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCO[C@]1(C2CCC(C#N)(CCCC)CC2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C31H45NO/c1-3-5-7-8-9-13-25-33-31(23-16-28(17-24-31)27-14-11-10-12-15-27)29-18-21-30(26-32,22-19-29)20-6-4-2/h10-12,14-17,23,29H,3-9,13,18-22,24-25H2,1-2H3/t29?,30?,31-/m1/s1 |
| InChIKey | SRHXOHQQCLNMLL-QMJLEDSTSA-N |
| XLogP | 9.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|