C28H39N — CID 23180752
4-(1-ethyl-4-phenylcyclohexa-2,5-dien-1-yl)-1-heptylcyclohexane-1-carbonitrile (PubChem CID 23180752) has the molecular formula C28H39N and a molecular weight of 389.63 g/mol. Its IUPAC name is 4-(1-ethyl-4-phenylcyclohexa-2,5-dien-1-yl)-1-heptylcyclohexane-1-carbonitrile.
| Compound Name | 4-(1-ethyl-4-phenylcyclohexa-2,5-dien-1-yl)-1-heptylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 23180752 |
| Molecular Formula | C28H39N |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | 4-(1-ethyl-4-phenylcyclohexa-2,5-dien-1-yl)-1-heptylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCCC1(C#N)CCC(C2(CC)C=CC(c3ccccc3)C=C2)CC1 |
| InChI | InChI=1S/C28H39N/c1-3-5-6-7-11-18-27(23-29)19-16-26(17-20-27)28(4-2)21-14-25(15-22-28)24-12-9-8-10-13-24/h8-10,12-15,21-22,25-26H,3-7,11,16-20H2,1-2H3 |
| InChIKey | QDWDUTAODXVEES-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|