C20H25N3O — CID 70159693
1-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 70159693) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 1-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 70159693 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[3-[(3R)-3-aminopyrrolidin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1(OCCCN2CC[C@@H](N)C2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C20H25N3O/c21-16-20(24-14-4-12-23-13-9-19(22)15-23)10-7-18(8-11-20)17-5-2-1-3-6-17/h1-3,5-8,10,19H,4,9,11-15,22H2/t19-,20?/m1/s1 |
| InChIKey | CSRLZCXNDLEESS-FIWHBWSRSA-N |
| XLogP | 2.73 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|