C23H29F3O2 — CID 174430197
5-(5-cyclopentylpentoxy)-2-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 174430197) has the molecular formula C23H29F3O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-(5-cyclopentylpentoxy)-2-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-diene.
| Compound Name | 5-(5-cyclopentylpentoxy)-2-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174430197 |
| Molecular Formula | C23H29F3O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 5-(5-cyclopentylpentoxy)-2-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)OC1(OCCCCCC2CCCC2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C23H29F3O2/c24-23(25,26)28-22(27-18-8-2-3-9-19-10-6-7-11-19)16-14-21(15-17-22)20-12-4-1-5-13-20/h1,4-5,12-16,19H,2-3,6-11,17-18H2 |
| InChIKey | OWZQBRBHIDFMGT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|