About 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal
3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal (PubChem CID 87754132) has the molecular formula C16H15F3O
and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal.
Molecular Properties
| Compound Name | 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal |
| PubChem CID | 87754132 |
| Molecular Formula | C16H15F3O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal |
| SMILES | O=CCCC1(C(F)(F)F)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H15F3O/c17-16(18,19)15(9-4-12-20)10-7-14(8-11-15)13-5-2-1-3-6-13/h1-3,5-8,10,12H,4,9,11H2 |
| InChIKey | WRKKENVSFUIDKL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal?
The IUPAC name of 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal (CID 87754132) is 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal.
What is the SMILES notation for 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal?
The canonical SMILES for 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal is O=CCCC1(C(F)(F)F)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal?
The InChIKey is WRKKENVSFUIDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3O/c17-16(18,19)15(9-4-12-20)10-7-14(8-11-15)13-5-2-1-3-6-13/h1-3,5-8,10,12H,4,9,11H2.
What are the key properties of 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal?
3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal has a molecular weight of 280.29 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-phenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanal is sourced from PubChem (CID 87754132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).