C17H20O3 — CID 174578286
1-(oxan-2-yloxy)-4-phenylcyclohexa-2,4-dien-1-ol (PubChem CID 174578286) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-(oxan-2-yloxy)-4-phenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(oxan-2-yloxy)-4-phenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174578286 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-(oxan-2-yloxy)-4-phenylcyclohexa-2,4-dien-1-ol |
| SMILES | OC1(OC2CCCCO2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H20O3/c18-17(20-16-8-4-5-13-19-16)11-9-15(10-12-17)14-6-2-1-3-7-14/h1-3,6-7,9-11,16,18H,4-5,8,12-13H2 |
| InChIKey | AXJADQJEHGSZGA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|