C10H10F2O3 — CID 125454964
(3S)-3-ethyl-6,7-difluoro-2H-1,4-benzodioxin-3-ol (PubChem CID 125454964) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is (3S)-3-ethyl-6,7-difluoro-2H-1,4-benzodioxin-3-ol.
| Compound Name | (3S)-3-ethyl-6,7-difluoro-2H-1,4-benzodioxin-3-ol |
|---|---|
| PubChem CID | 125454964 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (3S)-3-ethyl-6,7-difluoro-2H-1,4-benzodioxin-3-ol |
| SMILES | CC[C@@]1(O)COc2cc(F)c(F)cc2O1 |
| InChI | InChI=1S/C10H10F2O3/c1-2-10(13)5-14-8-3-6(11)7(12)4-9(8)15-10/h3-4,13H,2,5H2,1H3/t10-/m0/s1 |
| InChIKey | XLVSLBMFKKIJDQ-JTQLQIEISA-N |
| XLogP | 1.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |