C12H19NO3S — CID 115048075
3-(1-isocyanato-3,3-dimethylcyclobutyl)thiane 1,1-dioxide (PubChem CID 115048075) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-(1-isocyanato-3,3-dimethylcyclobutyl)thiane 1,1-dioxide.
| Compound Name | 3-(1-isocyanato-3,3-dimethylcyclobutyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115048075 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-(1-isocyanato-3,3-dimethylcyclobutyl)thiane 1,1-dioxide |
| SMILES | CC1(C)CC(N=C=O)(C2CCCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H19NO3S/c1-11(2)7-12(8-11,13-9-14)10-4-3-5-17(15,16)6-10/h10H,3-8H2,1-2H3 |
| InChIKey | OZAAUHUARJWMGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|