C11H16N2O2 — CID 87494925
1,1-diisocyanato-2,2,4-trimethylcyclohexane (PubChem CID 87494925) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,1-diisocyanato-2,2,4-trimethylcyclohexane.
| Compound Name | 1,1-diisocyanato-2,2,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 87494925 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1,1-diisocyanato-2,2,4-trimethylcyclohexane |
| SMILES | CC1CCC(N=C=O)(N=C=O)C(C)(C)C1 |
| InChI | InChI=1S/C11H16N2O2/c1-9-4-5-11(12-7-14,13-8-15)10(2,3)6-9/h9H,4-6H2,1-3H3 |
| InChIKey | PCEHUMUPUWKFLJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|